cas: 19817-88-0 — see every product listed under this CAS number, including other names
N-((2R,3R,4S,5R)-3,4,5,6-Tetrahydroxy-1-oxohexan-2-yl)hexanamide (CAS 19817-88-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113BCC-1g |
| cas | 19817-88-0 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 371.60 Pln | |
| Chemat | 250mg | 198.80 Pln |
| delivery time | 3 weeks |
|---|
N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]hexanamide (CAS 19817-88-0) is a chemical compound with the molecular formula C12H23NO6 and a molecular weight of 277.31 g/mol. IUPAC name: N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]hexanamide. InChIKey: QLZZYPWIRVQENX-LUTQBAROSA-N.
| Molecular formula | C12H23NO6 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]hexanamide |
| InChIKey | QLZZYPWIRVQENX-LUTQBAROSA-N |
| SMILES | CCCCCC(=O)N[C@@H](C=O)[C@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)