CAS 1365655-91-9 appears in our catalog under these names: 3-[2-(2-([(tert-Butoxy)carbonyl]amino)ethoxy)ethoxy]propanoic acid, 98%, Boc–NH–PEG2–CH2CH2COOH, 4,7,12-Trioxa-10-azatetradecanoic acid, 13,13-dimethyl-11-oxo-, Boc-NH-PEG2-acid, >95.0%(HPLC), Boc-NH-PEG2-CH2CH2COOH 95%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 5g, 25g, 10g, 250mg, 1g, 100mg, 50g, 100g.
3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoic acid (CAS 1365655-91-9) is a chemical compound with the molecular formula C12H23NO6 and a molecular weight of 277.31 g/mol. IUPAC name: 3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoic acid. InChIKey: OZMXZVCAXAQCHJ-UHFFFAOYSA-N.
| Molecular formula | C12H23NO6 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | 3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoic acid |
| InChIKey | OZMXZVCAXAQCHJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)