Products 19817-88-0
CAS 19817-88-0 appears in our catalog under these names: N-Hexanoyl-d-glucosamine, 98%, N-Hexanoyl-D-glucosamine, 95+%, N–Hexanoyl–D–glucosamine, N-Hexanoyl-D-glucosamine, >98.0%(N), N-Hexanoyl-D-glucosamine. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Biosynth. Available pack sizes: 5g, 250mg, 1g, 1000mg, 500mg, 2000mg, 5000mg, Get quote.
N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]hexanamide (CAS 19817-88-0) is a chemical compound with the molecular formula C12H23NO6 and a molecular weight of 277.31 g/mol. IUPAC name: N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]hexanamide. InChIKey: QLZZYPWIRVQENX-LUTQBAROSA-N.
| Molecular formula | C12H23NO6 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]hexanamide |
| InChIKey | QLZZYPWIRVQENX-LUTQBAROSA-N |
| SMILES | CCCCCC(=O)N[C@@H](C=O)[C@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)