CAS 104154-10-1 appears in our catalog under these names: N-(5-Carboxypentyl)-deoxymannojirimycin hydrochloride, 95%, N-(5-Carboxypentyl)-deoxymannojirimycin hydrochloride, N-5-Carboxypentyl-deoxymannojirimycin. Offered by: Chemat Brand, Biosynth, MedChemExpress. Available pack sizes: on request, 1mg, Get quote.
6-[(2R,3R,4R,5R)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexanoic acid (CAS 104154-10-1) is a chemical compound with the molecular formula C12H23NO6 and a molecular weight of 277.31 g/mol. IUPAC name: 6-[(2R,3R,4R,5R)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexanoic acid. InChIKey: KTNVTDIFZTZBJY-CNVPUSNMSA-N.
| Molecular formula | C12H23NO6 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | 6-[(2R,3R,4R,5R)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexanoic acid |
| InChIKey | KTNVTDIFZTZBJY-CNVPUSNMSA-N |
| SMILES | C1[C@H]([C@H]([C@@H]([C@H](N1CCCCCC(=O)O)CO)O)O)O |
Computed by PubChem (NCBI)