cas: 365-29-7 — see every product listed under this CAS number, including other names
N-(2,3,4-TRIFLUOROPHENYL)ACETAMIDE, 96% (CAS 365-29-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467287-250MG |
| cas | 365-29-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 830.98 Pln | |
| Fluorochem | 25g | 2720.93 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
N-(2,3,4-trifluorophenyl)acetamide (CAS 365-29-7) is a chemical compound with the molecular formula C8H6F3NO and a molecular weight of 189.13 g/mol. IUPAC name: N-(2,3,4-trifluorophenyl)acetamide. InChIKey: YHTIZYPWNFRADV-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO |
|---|---|
| Molecular weight | 189.13 g/mol |
| IUPAC name | N-(2,3,4-trifluorophenyl)acetamide |
| InChIKey | YHTIZYPWNFRADV-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C(=C(C=C1)F)F)F |
Computed by PubChem (NCBI)