cas: 365-29-7 — see every product listed under this CAS number, including other names
N-(2,3,4-Trifluorophenyl)acetamide, 96%, 96% (CAS 365-29-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CMSF-250mg |
| cas | 365-29-7 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 520.40 Pln | |
| Chemat | 25g | 1658.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
N-(2,3,4-trifluorophenyl)acetamide (CAS 365-29-7) is a chemical compound with the molecular formula C8H6F3NO and a molecular weight of 189.13 g/mol. IUPAC name: N-(2,3,4-trifluorophenyl)acetamide. InChIKey: YHTIZYPWNFRADV-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO |
|---|---|
| Molecular weight | 189.13 g/mol |
| IUPAC name | N-(2,3,4-trifluorophenyl)acetamide |
| InChIKey | YHTIZYPWNFRADV-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C(=C(C=C1)F)F)F |
Computed by PubChem (NCBI)