N-(2,3,5,6-Tetrafluorophenyl)acetamide, 95+%
cas: 1766-14-9 — see every product listed under this CAS number, including other names
N-(2,3,5,6-Tetrafluorophenyl)acetamide, 95+% (CAS 1766-14-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A438399-250mg |
| cas | 1766-14-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 626.25 Pln | |
| Ambeed | 5g | 2356.19 Pln | |
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 314.00 Pln | |
| Chemat | 1g | 736.40 Pln | |
| BLDpharm | 100mg | 203.29 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 669.79 Pln | |
| BLDpharm | 5g | 2535.80 Pln | |
| Fluorochem | 100mg | 362.39 Pln | |
| Fluorochem | 250mg | 560.24 Pln | |
| Fluorochem | 1g | 1367.24 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
N-(2,3,5,6-tetrafluorophenyl)acetamide (CAS 1766-14-9) is a chemical compound with the molecular formula C8H5F4NO and a molecular weight of 207.12 g/mol. IUPAC name: N-(2,3,5,6-tetrafluorophenyl)acetamide. InChIKey: YACCDYDHWZNJOA-UHFFFAOYSA-N.
| Molecular formula | C8H5F4NO |
|---|---|
| Molecular weight | 207.12 g/mol |
| IUPAC name | N-(2,3,5,6-tetrafluorophenyl)acetamide |
| InChIKey | YACCDYDHWZNJOA-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C(=CC(=C1F)F)F)F |
Computed by PubChem (NCBI)