CAS 207853-64-3 appears in our catalog under these names: 2-Fluoro-4-(trifluoromethyl)benzamide, 97%, 2-Fluoro-4-(trifluoromethyl)benzamide 98%, 2-Fluoro-4-(trifluoromethyl)benzamide, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g, 100g.
2-fluoro-4-(trifluoromethyl)benzamide (CAS 207853-64-3) is a chemical compound with the molecular formula C8H5F4NO and a molecular weight of 207.12 g/mol. IUPAC name: 2-fluoro-4-(trifluoromethyl)benzamide. InChIKey: BQNZIRSNAKWERJ-UHFFFAOYSA-N.
| Molecular formula | C8H5F4NO |
|---|---|
| Molecular weight | 207.12 g/mol |
| IUPAC name | 2-fluoro-4-(trifluoromethyl)benzamide |
| InChIKey | BQNZIRSNAKWERJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)F)C(=O)N |
Computed by PubChem (NCBI)