CAS 214288-07-0 appears in our catalog under these names: 1-(2-Amino-5-fluorophenyl)-2,2,2-trifluoroethanone, 95%, 1-(2-Amino-5-fluorophenyl)-2,2,2-trifluoroethanone, 95+%, 1–(2–Amino–5–fluorophenyl)–2,2,2–trifluoroethanone. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
1-(2-amino-5-fluorophenyl)-2,2,2-trifluoroethanone (CAS 214288-07-0) is a chemical compound with the molecular formula C8H5F4NO and a molecular weight of 207.12 g/mol. IUPAC name: 1-(2-amino-5-fluorophenyl)-2,2,2-trifluoroethanone. InChIKey: YWPZGQVYRTUGEL-UHFFFAOYSA-N.
| Molecular formula | C8H5F4NO |
|---|---|
| Molecular weight | 207.12 g/mol |
| IUPAC name | 1-(2-amino-5-fluorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | YWPZGQVYRTUGEL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)C(F)(F)F)N |
Computed by PubChem (NCBI)