CAS 35980-21-3 is the registry number for 2,2,2-Trifluoro-N-(3-fluorophenyl)acetamide, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 10g, 1g.
2,2,2-trifluoro-N-(3-fluorophenyl)acetamide (CAS 35980-21-3) is a chemical compound with the molecular formula C8H5F4NO and a molecular weight of 207.12 g/mol. IUPAC name: 2,2,2-trifluoro-N-(3-fluorophenyl)acetamide. InChIKey: WWKUHNUESPCMSE-UHFFFAOYSA-N.
| Molecular formula | C8H5F4NO |
|---|---|
| Molecular weight | 207.12 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-(3-fluorophenyl)acetamide |
| InChIKey | WWKUHNUESPCMSE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)