cas: 56393-56-7 — see every product listed under this CAS number, including other names
N-(2,5-Dimethoxyphenyl)-4-methylbenzenesulfonamide 95% (CAS 56393-56-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A984439-250mg |
| cas | 56393-56-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 670.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A984439 |
N-(2,5-dimethoxyphenyl)-4-methylbenzenesulfonamide (CAS 56393-56-7) is a chemical compound with the molecular formula C15H17NO4S and a molecular weight of 307.4 g/mol. IUPAC name: N-(2,5-dimethoxyphenyl)-4-methylbenzenesulfonamide. InChIKey: ZYOPCYFVPCXDGF-UHFFFAOYSA-N.
| Molecular formula | C15H17NO4S |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | N-(2,5-dimethoxyphenyl)-4-methylbenzenesulfonamide |
| InChIKey | ZYOPCYFVPCXDGF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=C(C=CC(=C2)OC)OC |
Computed by PubChem (NCBI)