cas: 56393-56-7 — see every product listed under this CAS number, including other names
N-(2,5-Dimethoxyphenyl)-4-methylbenzenesulfonamide, 95%, 95% (CAS 56393-56-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120EN8-250mg |
| cas | 56393-56-7 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 722.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-(2,5-dimethoxyphenyl)-4-methylbenzenesulfonamide (CAS 56393-56-7) is a chemical compound with the molecular formula C15H17NO4S and a molecular weight of 307.4 g/mol. IUPAC name: N-(2,5-dimethoxyphenyl)-4-methylbenzenesulfonamide. InChIKey: ZYOPCYFVPCXDGF-UHFFFAOYSA-N.
| Molecular formula | C15H17NO4S |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | N-(2,5-dimethoxyphenyl)-4-methylbenzenesulfonamide |
| InChIKey | ZYOPCYFVPCXDGF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=C(C=CC(=C2)OC)OC |
Computed by PubChem (NCBI)