Products 859827-47-7
CAS 859827-47-7 is the registry number for 2-(6-Methoxynaphthalen-2-yl)-N-(methylsulfonyl)propanamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(6-methoxynaphthalen-2-yl)-N-methylsulfonylpropanamide (CAS 859827-47-7) is a chemical compound with the molecular formula C15H17NO4S and a molecular weight of 307.4 g/mol. IUPAC name: 2-(6-methoxynaphthalen-2-yl)-N-methylsulfonylpropanamide. InChIKey: HFZLMDUPSMGSOP-UHFFFAOYSA-N.
| Molecular formula | C15H17NO4S |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | 2-(6-methoxynaphthalen-2-yl)-N-methylsulfonylpropanamide |
| InChIKey | HFZLMDUPSMGSOP-UHFFFAOYSA-N |
| SMILES | CC(C1=CC2=C(C=C1)C=C(C=C2)OC)C(=O)NS(=O)(=O)C |
Computed by PubChem (NCBI)