Products 1303732-30-0
CAS 1303732-30-0 is the registry number for 4-hydroxy-N-[(4-methoxyphenyl)methyl]-N-methylbenzene-1-sulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-hydroxy-N-[(4-methoxyphenyl)methyl]-N-methylbenzenesulfonamide (CAS 1303732-30-0) is a chemical compound with the molecular formula C15H17NO4S and a molecular weight of 307.4 g/mol. IUPAC name: 4-hydroxy-N-[(4-methoxyphenyl)methyl]-N-methylbenzenesulfonamide. InChIKey: MYNXISRREOEZSK-UHFFFAOYSA-N.
| Molecular formula | C15H17NO4S |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | 4-hydroxy-N-[(4-methoxyphenyl)methyl]-N-methylbenzenesulfonamide |
| InChIKey | MYNXISRREOEZSK-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=C(C=C1)OC)S(=O)(=O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)