cas: 4703-15-5 — see every product listed under this CAS number, including other names
N-(2,6-dimethylphenyl)-4-methylbenzenesulfonamide, 97%, 97% (CAS 4703-15-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DIRF-100mg |
| cas | 4703-15-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 376.40 Pln | |
| Chemat | 1g | 880.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N-(2,6-dimethylphenyl)-4-methylbenzenesulfonamide (CAS 4703-15-5) is a chemical compound with the molecular formula C15H17NO2S and a molecular weight of 275.4 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-4-methylbenzenesulfonamide. InChIKey: SEYRJIDJWCOIBS-UHFFFAOYSA-N.
| Molecular formula | C15H17NO2S |
|---|---|
| Molecular weight | 275.4 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-4-methylbenzenesulfonamide |
| InChIKey | SEYRJIDJWCOIBS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=C(C=CC=C2C)C |
Computed by PubChem (NCBI)