cas: 131395-29-4 — see every product listed under this CAS number, including other names
N-(2-Bromo-4-(trifluoromethoxy)phenyl)acetamide, 97%, 97% (CAS 131395-29-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111W3W-1g |
| cas | 131395-29-4 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 25g | 395.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N-[2-bromo-4-(trifluoromethoxy)phenyl]acetamide (CAS 131395-29-4) is a chemical compound with the molecular formula C9H7BrF3NO2 and a molecular weight of 298.06 g/mol. IUPAC name: N-[2-bromo-4-(trifluoromethoxy)phenyl]acetamide. InChIKey: ZTFDDTDGNZYFAA-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF3NO2 |
|---|---|
| Molecular weight | 298.06 g/mol |
| IUPAC name | N-[2-bromo-4-(trifluoromethoxy)phenyl]acetamide |
| InChIKey | ZTFDDTDGNZYFAA-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)OC(F)(F)F)Br |
Computed by PubChem (NCBI)