CAS 1443763-87-8 is the registry number for 4-Bromo-3-(2,2,2-trifluoroethoxy)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-bromo-3-(2,2,2-trifluoroethoxy)benzamide (CAS 1443763-87-8) is a chemical compound with the molecular formula C9H7BrF3NO2 and a molecular weight of 298.06 g/mol. IUPAC name: 4-bromo-3-(2,2,2-trifluoroethoxy)benzamide. InChIKey: CFRDJNOBCVXNRR-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF3NO2 |
|---|---|
| Molecular weight | 298.06 g/mol |
| IUPAC name | 4-bromo-3-(2,2,2-trifluoroethoxy)benzamide |
| InChIKey | CFRDJNOBCVXNRR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)N)OCC(F)(F)F)Br |
Computed by PubChem (NCBI)