Products 1805624-33-2
CAS 1805624-33-2 is the registry number for Methyl 2-amino-3-bromo-5-(trifluoromethyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Methyl 2-amino-3-bromo-5-(trifluoromethyl)benzoate (CAS 1805624-33-2) is a chemical compound with the molecular formula C9H7BrF3NO2 and a molecular weight of 298.06 g/mol. IUPAC name: methyl 2-amino-3-bromo-5-(trifluoromethyl)benzoate. InChIKey: BLROLEDEZYXSBA-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF3NO2 |
|---|---|
| Molecular weight | 298.06 g/mol |
| IUPAC name | methyl 2-amino-3-bromo-5-(trifluoromethyl)benzoate |
| InChIKey | BLROLEDEZYXSBA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)C(F)(F)F)Br)N |
Computed by PubChem (NCBI)