Products 755030-17-2
CAS 755030-17-2 is the registry number for N-[3-bromo-4-(trifluoromethoxy)phenyl]acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-[3-bromo-4-(trifluoromethoxy)phenyl]acetamide (CAS 755030-17-2) is a chemical compound with the molecular formula C9H7BrF3NO2 and a molecular weight of 298.06 g/mol. IUPAC name: N-[3-bromo-4-(trifluoromethoxy)phenyl]acetamide. InChIKey: RHHGKDDKXSSPOF-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF3NO2 |
|---|---|
| Molecular weight | 298.06 g/mol |
| IUPAC name | N-[3-bromo-4-(trifluoromethoxy)phenyl]acetamide |
| InChIKey | RHHGKDDKXSSPOF-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1)OC(F)(F)F)Br |
Computed by PubChem (NCBI)