cas: 3184-74-5 — see every product listed under this CAS number, including other names
N-(2-Carboxyacetyl)-D-Trp-OH 95% (CAS 3184-74-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A974396-100mg |
| cas | 3184-74-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 1316.00 Pln | |
| Ambeed | 5g | 4848.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A974396 |
2-(2,4-dioxoazetidin-1-yl)-3-(1H-indol-3-yl)propanoic acid (CAS 3184-74-5) is a chemical compound with the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. IUPAC name: 2-(2,4-dioxoazetidin-1-yl)-3-(1H-indol-3-yl)propanoic acid. InChIKey: IMEFCKUOVURQRP-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O4 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | 2-(2,4-dioxoazetidin-1-yl)-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | IMEFCKUOVURQRP-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C1=O)C(CC2=CNC3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)