CAS 128612-43-1 is the registry number for Dimethyl 3,3'-bipyridine-5,5'-dicarboxylate, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 5-(5-methoxycarbonyl-3-pyridinyl)pyridine-3-carboxylate (CAS 128612-43-1) is a chemical compound with the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. IUPAC name: methyl 5-(5-methoxycarbonyl-3-pyridinyl)pyridine-3-carboxylate. InChIKey: FHLQRZZILYBCDV-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O4 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | methyl 5-(5-methoxycarbonyl-3-pyridinyl)pyridine-3-carboxylate |
| InChIKey | FHLQRZZILYBCDV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=CC(=C1)C2=CC(=CN=C2)C(=O)OC |
Computed by PubChem (NCBI)