Products 1400644-88-3
CAS 1400644-88-3 appears in our catalog under these names: 3–(Benzylamino)–4–nitrobenzoic acid, 3-(Benzylamino)-4-nitrobenzoic acid, 96%, 3-(Benzylamino)-4-nitrobenzoic acid, 98%, 3-(Benzylamino)-4-nitrobenzoic acid, 98%, 98%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g.
3-(benzylamino)-4-nitrobenzoic acid (CAS 1400644-88-3) is a chemical compound with the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. IUPAC name: 3-(benzylamino)-4-nitrobenzoic acid. InChIKey: FWMVBTNEUYMWCZ-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O4 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | 3-(benzylamino)-4-nitrobenzoic acid |
| InChIKey | FWMVBTNEUYMWCZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=C(C=CC(=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)