CAS 3184-74-5 appears in our catalog under these names: N-(2-Carboxyacetyl)-D-tryptophan, 95%, N–(2–Carboxyacetyl)–D–tryptophan, N-(2-Carboxyacetyl)-D-Trp-OH 95%, N-(2-Carboxyacetyl)-D-tryptophan, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
2-(2,4-dioxoazetidin-1-yl)-3-(1H-indol-3-yl)propanoic acid (CAS 3184-74-5) is a chemical compound with the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. IUPAC name: 2-(2,4-dioxoazetidin-1-yl)-3-(1H-indol-3-yl)propanoic acid. InChIKey: IMEFCKUOVURQRP-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O4 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | 2-(2,4-dioxoazetidin-1-yl)-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | IMEFCKUOVURQRP-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C1=O)C(CC2=CNC3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)