cas: 269410-27-7 — see every product listed under this CAS number, including other names
N-(2-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide 98% (CAS 269410-27-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A738607-100mg |
| cas | 269410-27-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 320.31 Pln | |
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1115.75 Pln | |
| Ambeed | 5g | 3001.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A738607 |
N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 269410-27-7) is a chemical compound with the molecular formula C14H19BFNO3 and a molecular weight of 279.12 g/mol. IUPAC name: N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: LCMXRFQDZUWQLO-UHFFFAOYSA-N.
| Molecular formula | C14H19BFNO3 |
|---|---|
| Molecular weight | 279.12 g/mol |
| IUPAC name | N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| InChIKey | LCMXRFQDZUWQLO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)NC(=O)C)F |
Computed by PubChem (NCBI)