cas: 368-11-6 — see every product listed under this CAS number, including other names
N-(2-Hydroxy-5-(trifluoromethyl)phenyl)acetamide 95% (CAS 368-11-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A798848-50mg |
| cas | 368-11-6 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 1805.50 Pln | |
| Ambeed | 100mg | 2628.75 Pln | |
| Ambeed | 250mg | 3707.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A798848 |
N-[2-hydroxy-5-(trifluoromethyl)phenyl]acetamide (CAS 368-11-6) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: N-[2-hydroxy-5-(trifluoromethyl)phenyl]acetamide. InChIKey: HLRHQQAQHBXWCG-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | N-[2-hydroxy-5-(trifluoromethyl)phenyl]acetamide |
| InChIKey | HLRHQQAQHBXWCG-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC(=C1)C(F)(F)F)O |
Computed by PubChem (NCBI)