CAS 368-11-6 appears in our catalog under these names: 2-Acetamino-4-(trifluoromethyl)phenol, 95%, N-(2-Hydroxy-5-(trifluoromethyl)phenyl)acetamide 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 50mg, 100mg, 250mg.
N-[2-hydroxy-5-(trifluoromethyl)phenyl]acetamide (CAS 368-11-6) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: N-[2-hydroxy-5-(trifluoromethyl)phenyl]acetamide. InChIKey: HLRHQQAQHBXWCG-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | N-[2-hydroxy-5-(trifluoromethyl)phenyl]acetamide |
| InChIKey | HLRHQQAQHBXWCG-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC(=C1)C(F)(F)F)O |
Computed by PubChem (NCBI)