cas: 81253-53-4 — see every product listed under this CAS number, including other names
N-(2-aminoethyl)pyridine-4-carboxamide dihydrochloride, 97%, 97% (CAS 81253-53-4) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FLE9-500mg |
| cas | 81253-53-4 |
| size | 500mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 645.20 Pln | |
| Chemat | 1g | 947.60 Pln | |
| Chemat | 5g | 2718.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N-(2-aminoethyl)pyridine-4-carboxamide;dihydrochloride (CAS 81253-53-4) is a chemical compound with the molecular formula C8H13Cl2N3O and a molecular weight of 238.11 g/mol. IUPAC name: N-(2-aminoethyl)pyridine-4-carboxamide;dihydrochloride. InChIKey: PXTBBSDHPDZYGD-UHFFFAOYSA-N.
| Molecular formula | C8H13Cl2N3O |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | N-(2-aminoethyl)pyridine-4-carboxamide;dihydrochloride |
| InChIKey | PXTBBSDHPDZYGD-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C(=O)NCCN.Cl.Cl |
Computed by PubChem (NCBI)