CAS 1982213-80-8 appears in our catalog under these names: 3,5,6,7,8,9-Hexahydro-4h-pyrimido[4,5-d]azepin-4-one dihydrochloride, 95%, 3,5,6,7,8,9-Hexahydro-4H-pyrimido(4,5-d)azepin-4-one dihydrochloride, 97%, 3H,4H,5H,6H,7H,8H,9H-Pyrimido(4,5-d)azepin-4-one dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 2,5g.
3,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-4-one;dihydrochloride (CAS 1982213-80-8) is a chemical compound with the molecular formula C8H13Cl2N3O and a molecular weight of 238.11 g/mol. IUPAC name: 3,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-4-one;dihydrochloride. InChIKey: JZLXTXQGGXXTOX-UHFFFAOYSA-N.
| Molecular formula | C8H13Cl2N3O |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | 3,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-4-one;dihydrochloride |
| InChIKey | JZLXTXQGGXXTOX-UHFFFAOYSA-N |
| SMILES | C1CNCCC2=C1C(=O)NC=N2.Cl.Cl |
Computed by PubChem (NCBI)