CAS 1803598-30-2 appears in our catalog under these names: 3-Methyl-3H,4H,5H,6H,7H,8H-pyrido(3,4-d)pyrimidin-4-one dihydrochloride, 95%, 3-Methyl-3H,4H,5H,6H,7H,8H-pyrido(3,4-d)pyrimidin-4-one dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-one;dihydrochloride (CAS 1803598-30-2) is a chemical compound with the molecular formula C8H13Cl2N3O and a molecular weight of 238.11 g/mol. IUPAC name: 3-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-one;dihydrochloride. InChIKey: JFTFYKHHNCVWEY-UHFFFAOYSA-N.
| Molecular formula | C8H13Cl2N3O |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | 3-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-one;dihydrochloride |
| InChIKey | JFTFYKHHNCVWEY-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C(C1=O)CCNC2.Cl.Cl |
Computed by PubChem (NCBI)