CAS 1170085-23-0 appears in our catalog under these names: 3-Amino-n-(pyridin-2-yl)propanamide dihydrochloride, 95%, 3-Amino-N-(pyridin-2-yl)propanamide dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-amino-N-pyridin-2-ylpropanamide;dihydrochloride (CAS 1170085-23-0) is a chemical compound with the molecular formula C8H13Cl2N3O and a molecular weight of 238.11 g/mol. IUPAC name: 3-amino-N-pyridin-2-ylpropanamide;dihydrochloride. InChIKey: JUDNGRBRIVIGQJ-UHFFFAOYSA-N.
| Molecular formula | C8H13Cl2N3O |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | 3-amino-N-pyridin-2-ylpropanamide;dihydrochloride |
| InChIKey | JUDNGRBRIVIGQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)NC(=O)CCN.Cl.Cl |
Computed by PubChem (NCBI)