cas: 22364-28-9 — see every product listed under this CAS number, including other names
N-(2-bromo-4,5-dimethylphenyl)acetamide, 97%, 97% (CAS 22364-28-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C5LH-100mg |
| cas | 22364-28-9 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 803.60 Pln | |
| Chemat | 1g | 1893.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N-(2-bromo-4,5-dimethylphenyl)acetamide (CAS 22364-28-9) is a chemical compound with the molecular formula C10H12BrNO and a molecular weight of 242.11 g/mol. IUPAC name: N-(2-bromo-4,5-dimethylphenyl)acetamide. InChIKey: SUNBHBXAMLHMAE-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO |
|---|---|
| Molecular weight | 242.11 g/mol |
| IUPAC name | N-(2-bromo-4,5-dimethylphenyl)acetamide |
| InChIKey | SUNBHBXAMLHMAE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)Br)NC(=O)C |
Computed by PubChem (NCBI)