cas: 113975-33-0 — see every product listed under this CAS number, including other names
N-(3-Iodopyridin-4-yl)pivalamide 98% (CAS 113975-33-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A160910-5g |
| cas | 113975-33-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 298.06 Pln | |
| Ambeed | 10g | 476.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A160910 |
N-(3-iodo-4-pyridinyl)-2,2-dimethylpropanamide (CAS 113975-33-0) is a chemical compound with the molecular formula C10H13IN2O and a molecular weight of 304.13 g/mol. IUPAC name: N-(3-iodo-4-pyridinyl)-2,2-dimethylpropanamide. InChIKey: GPMKCDBJLNTANL-UHFFFAOYSA-N.
| Molecular formula | C10H13IN2O |
|---|---|
| Molecular weight | 304.13 g/mol |
| IUPAC name | N-(3-iodo-4-pyridinyl)-2,2-dimethylpropanamide |
| InChIKey | GPMKCDBJLNTANL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=NC=C1)I |
Computed by PubChem (NCBI)