CAS 113975-33-0 appears in our catalog under these names: N-(3-Iodo-pyridin-4-yl)-2,2-dimethyl-propionamide, 95%, 3–Iodo–4–(2,2,2–trimethylacetamido)pyridine, N-(3-Iodopyridin-4-yl)pivalamide 98%, N-(3-iodopyridin-4-yl)-2,2-dimethylpropanamide, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 25g.
N-(3-iodo-4-pyridinyl)-2,2-dimethylpropanamide (CAS 113975-33-0) is a chemical compound with the molecular formula C10H13IN2O and a molecular weight of 304.13 g/mol. IUPAC name: N-(3-iodo-4-pyridinyl)-2,2-dimethylpropanamide. InChIKey: GPMKCDBJLNTANL-UHFFFAOYSA-N.
| Molecular formula | C10H13IN2O |
|---|---|
| Molecular weight | 304.13 g/mol |
| IUPAC name | N-(3-iodo-4-pyridinyl)-2,2-dimethylpropanamide |
| InChIKey | GPMKCDBJLNTANL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=NC=C1)I |
Computed by PubChem (NCBI)