cas: 113975-33-0 — see every product listed under this CAS number, including other names
N-(3-iodopyridin-4-yl)-2,2-dimethylpropanamide, 98% (CAS 113975-33-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F375496-1G |
| cas | 113975-33-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 216.61 Pln | |
| Fluorochem | 10g | 372.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
N-(3-iodo-4-pyridinyl)-2,2-dimethylpropanamide (CAS 113975-33-0) is a chemical compound with the molecular formula C10H13IN2O and a molecular weight of 304.13 g/mol. IUPAC name: N-(3-iodo-4-pyridinyl)-2,2-dimethylpropanamide. InChIKey: GPMKCDBJLNTANL-UHFFFAOYSA-N.
| Molecular formula | C10H13IN2O |
|---|---|
| Molecular weight | 304.13 g/mol |
| IUPAC name | N-(3-iodo-4-pyridinyl)-2,2-dimethylpropanamide |
| InChIKey | GPMKCDBJLNTANL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=NC=C1)I |
Computed by PubChem (NCBI)