CAS 873302-38-6 is the registry number for N-(5-Iodo-pyridin-3-yl)-2,2-dimethyl-propionamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-(5-iodo-3-pyridinyl)-2,2-dimethylpropanamide (CAS 873302-38-6) is a chemical compound with the molecular formula C10H13IN2O and a molecular weight of 304.13 g/mol. IUPAC name: N-(5-iodo-3-pyridinyl)-2,2-dimethylpropanamide. InChIKey: ONCHDNICOXMWJL-UHFFFAOYSA-N.
| Molecular formula | C10H13IN2O |
|---|---|
| Molecular weight | 304.13 g/mol |
| IUPAC name | N-(5-iodo-3-pyridinyl)-2,2-dimethylpropanamide |
| InChIKey | ONCHDNICOXMWJL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC(=CN=C1)I |
Computed by PubChem (NCBI)