cas: 122-28-1 — see every product listed under this CAS number, including other names
N-(3-Nitrophenyl)acetamide 98% (CAS 122-28-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A196042-1g |
| cas | 122-28-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 170.12 Pln | |
| Ambeed | 25g | 359.25 Pln | |
| Ambeed | 100g | 1082.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A196042 |
N-(3-nitrophenyl)acetamide (CAS 122-28-1) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: N-(3-nitrophenyl)acetamide. InChIKey: KFTYNYHJHKCRKU-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | N-(3-nitrophenyl)acetamide |
| InChIKey | KFTYNYHJHKCRKU-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)