cas: 19514-92-2 — see every product listed under this CAS number, including other names
N-(4-(Benzyloxy)phenyl)-2-chloroacetamide, 97%, 97% (CAS 19514-92-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11APN0-250mg |
| cas | 19514-92-2 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 659.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-chloro-N-(4-phenylmethoxyphenyl)acetamide (CAS 19514-92-2) is a chemical compound with the molecular formula C15H14ClNO2 and a molecular weight of 275.73 g/mol. IUPAC name: 2-chloro-N-(4-phenylmethoxyphenyl)acetamide. InChIKey: TUTQONMCEZLRPX-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO2 |
|---|---|
| Molecular weight | 275.73 g/mol |
| IUPAC name | 2-chloro-N-(4-phenylmethoxyphenyl)acetamide |
| InChIKey | TUTQONMCEZLRPX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)NC(=O)CCl |
Computed by PubChem (NCBI)