cas: 32857-48-0 — see every product listed under this CAS number, including other names
N-(4-BROMOPHENYL)-4-METHYLBENZENESULFONAMIDE, 98% (CAS 32857-48-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F474531-100MG |
| cas | 32857-48-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 107.27 Pln | |
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 487.35 Pln | |
| Fluorochem | 5g | 1721.29 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
N-(4-bromophenyl)-4-methylbenzenesulfonamide (CAS 32857-48-0) is a chemical compound with the molecular formula C13H12BrNO2S and a molecular weight of 326.21 g/mol. IUPAC name: N-(4-bromophenyl)-4-methylbenzenesulfonamide. InChIKey: RIBFVUXANOZLHJ-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO2S |
|---|---|
| Molecular weight | 326.21 g/mol |
| IUPAC name | N-(4-bromophenyl)-4-methylbenzenesulfonamide |
| InChIKey | RIBFVUXANOZLHJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)