CAS 625470-36-2 is the registry number for N-Benzyl 3-bromobenzenesulfonamide, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 500g, 5g, 100g, 1g.
N-benzyl-3-bromobenzenesulfonamide (CAS 625470-36-2) is a chemical compound with the molecular formula C13H12BrNO2S and a molecular weight of 326.21 g/mol. IUPAC name: N-benzyl-3-bromobenzenesulfonamide. InChIKey: HTAWYJSLZQALKS-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO2S |
|---|---|
| Molecular weight | 326.21 g/mol |
| IUPAC name | N-benzyl-3-bromobenzenesulfonamide |
| InChIKey | HTAWYJSLZQALKS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNS(=O)(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)