CAS 1207175-67-4 is the registry number for Ethyl 2-(4-bromobenzyl)-1,3-thiazole-4-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
Ethyl 2-[(4-bromophenyl)methyl]-1,3-thiazole-4-carboxylate (CAS 1207175-67-4) is a chemical compound with the molecular formula C13H12BrNO2S and a molecular weight of 326.21 g/mol. IUPAC name: ethyl 2-[(4-bromophenyl)methyl]-1,3-thiazole-4-carboxylate. InChIKey: DUGFDLOSJSGBAZ-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO2S |
|---|---|
| Molecular weight | 326.21 g/mol |
| IUPAC name | ethyl 2-[(4-bromophenyl)methyl]-1,3-thiazole-4-carboxylate |
| InChIKey | DUGFDLOSJSGBAZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)CC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)