Products 91076-96-9

CAS 91076-96-9 is the registry number for 3-Amino-5-(4-bromo-phenyl)-thiophene-2-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

Ethyl 3-amino-5-(4-bromophenyl)thiophene-2-carboxylate (CAS 91076-96-9) is a chemical compound with the molecular formula C13H12BrNO2S and a molecular weight of 326.21 g/mol. IUPAC name: ethyl 3-amino-5-(4-bromophenyl)thiophene-2-carboxylate. InChIKey: JKLWLDQXFCTDSF-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12BrNO2S
Molecular weight326.21 g/mol
IUPAC nameethyl 3-amino-5-(4-bromophenyl)thiophene-2-carboxylate
InChIKeyJKLWLDQXFCTDSF-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C=C(S1)C2=CC=C(C=C2)Br)N

Computed by PubChem (NCBI)