cas: 633335-80-5 — see every product listed under this CAS number, including other names
N-(4-Bromo-5-fluoro-2-methylphenyl)acetamide, 97%, 97% (CAS 633335-80-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EKPB-100mg |
| cas | 633335-80-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 500mg | 275.60 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 5g | 971.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N-(4-bromo-5-fluoro-2-methylphenyl)acetamide (CAS 633335-80-5) is a chemical compound with the molecular formula C9H9BrFNO and a molecular weight of 246.08 g/mol. IUPAC name: N-(4-bromo-5-fluoro-2-methylphenyl)acetamide. InChIKey: KCEWAUIVDCPPQJ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrFNO |
|---|---|
| Molecular weight | 246.08 g/mol |
| IUPAC name | N-(4-bromo-5-fluoro-2-methylphenyl)acetamide |
| InChIKey | KCEWAUIVDCPPQJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1NC(=O)C)F)Br |
Computed by PubChem (NCBI)