CAS 893420-59-2 appears in our catalog under these names: 4-Bromo-3-fluoro-n,n-dimethylbenzamide, 95%, 4-Bromo-3-fluoro-N,N-dimethylbenzamide, 4-Bromo-3-fluoro-N,N-dimethylbenzamide, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 5g, 2,5g, 250mg, 100mg, 10g, 25g.
4-bromo-3-fluoro-N,N-dimethylbenzamide (CAS 893420-59-2) is a chemical compound with the molecular formula C9H9BrFNO and a molecular weight of 246.08 g/mol. IUPAC name: 4-bromo-3-fluoro-N,N-dimethylbenzamide. InChIKey: SQSHZRBCVHCKPX-UHFFFAOYSA-N.
| Molecular formula | C9H9BrFNO |
|---|---|
| Molecular weight | 246.08 g/mol |
| IUPAC name | 4-bromo-3-fluoro-N,N-dimethylbenzamide |
| InChIKey | SQSHZRBCVHCKPX-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=C(C=C1)Br)F |
Computed by PubChem (NCBI)