N-(4-Bromophenyl)-1,3-propanesultam, >95%, >95%
cas: 71703-16-7 — see every product listed under this CAS number, including other names
N-(4-Bromophenyl)-1,3-propanesultam, >95%, >95% (CAS 71703-16-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116QJV-250mg |
| cas | 71703-16-7 |
| size | 250mg |
| availability | 75g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 448.40 Pln | |
| Chemat | 5g | 1096.40 Pln | |
| Chemat | 10g | 1854.80 Pln | |
| Chemat | 25g | 3678.80 Pln | |
| Chemat | 100mg | 222.80 Pln |
properties
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
2-(4-bromophenyl)-1,2-thiazolidine 1,1-dioxide (CAS 71703-16-7) is a chemical compound with the molecular formula C9H10BrNO2S and a molecular weight of 276.15 g/mol. IUPAC name: 2-(4-bromophenyl)-1,2-thiazolidine 1,1-dioxide. InChIKey: LYQGSNNXYYJBLO-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2S |
|---|---|
| Molecular weight | 276.15 g/mol |
| IUPAC name | 2-(4-bromophenyl)-1,2-thiazolidine 1,1-dioxide |
| InChIKey | LYQGSNNXYYJBLO-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)
Synonyms:
2-(4-bromophenyl)-1,2-thiazolidine-1,1-dione, 2-(4-Bromophenyl)isothiazolidine 1,1-dioxide, N-(4-Bromophenyl)-1,3-propanesultam, 2-(4-bromophenyl)-1,2-thiazolidine 1,1-dioxide, 2-(4-Bromophenyl)isothiazolidine1,1-dioxide, LYQGSNNXYYJBLO-UHFFFAOYSA-N, 2-(4-bromophenyl)-1lambda,2-thiazolidine-1,1-dione, 2-(4-bromophenyl)-1lambda6,2-thiazolidine-1,1-dione, 2-(4-Bromophenyl)-1lambda~6~,2-thiazolidine-1,1-dione