cas: 37028-85-6 — see every product listed under this CAS number, including other names
N-(4-Carboxyphenyl)-p-toluenesulfonamide, ≥95%, ≥95% (CAS 37028-85-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CLOJ-250mg |
| cas | 37028-85-6 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 376.40 Pln | |
| Chemat | 5g | 1245.20 Pln | |
| Chemat | 25g | 4269.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
4-[(4-methylphenyl)sulfonylamino]benzoic acid (CAS 37028-85-6) is a chemical compound with the molecular formula C14H13NO4S and a molecular weight of 291.32 g/mol. IUPAC name: 4-[(4-methylphenyl)sulfonylamino]benzoic acid. InChIKey: ZEUVKKKFDVRMIM-UHFFFAOYSA-N.
| Molecular formula | C14H13NO4S |
|---|---|
| Molecular weight | 291.32 g/mol |
| IUPAC name | 4-[(4-methylphenyl)sulfonylamino]benzoic acid |
| InChIKey | ZEUVKKKFDVRMIM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)