N-(4-Hydroxyphenyl)methanesulfonamide, 98%
cas: 51767-39-6 — see every product listed under this CAS number, including other names
N-(4-Hydroxyphenyl)methanesulfonamide, 98% (CAS 51767-39-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: BLDpharm, Chemat, Fluorochem.
| brand | BLDpharm |
|---|---|
| catalog number | BD162699-100mg |
| cas | 51767-39-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 236.61 Pln | |
| BLDpharm | 1g | 325.47 Pln | |
| BLDpharm | 5g | 780.86 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 237.20 Pln | |
| Chemat | 5g | 654.80 Pln | |
| Chemat | 10g | 1192.40 Pln | |
| Chemat | 25g | 2320.40 Pln | |
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 336.36 Pln | |
| Fluorochem | 5g | 747.67 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
N-(4-hydroxyphenyl)methanesulfonamide (CAS 51767-39-6) is a chemical compound with the molecular formula C7H9NO3S and a molecular weight of 187.22 g/mol. IUPAC name: N-(4-hydroxyphenyl)methanesulfonamide. InChIKey: YJASRJZSSUOGKB-UHFFFAOYSA-N.
| Molecular formula | C7H9NO3S |
|---|---|
| Molecular weight | 187.22 g/mol |
| IUPAC name | N-(4-hydroxyphenyl)methanesulfonamide |
| InChIKey | YJASRJZSSUOGKB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC=C(C=C1)O |
Computed by PubChem (NCBI)