cas: 59642-21-6 — see every product listed under this CAS number, including other names
N-(4-Nitrobenzoyl)-beta-alanine, 98%(HPLC),RG, 98%(HPLC),RG (CAS 59642-21-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IAKY-1g |
| cas | 59642-21-6 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 25g | 179.60 Pln |
| purity | 98%(HPLC),RG |
|---|---|
| delivery time | 3 weeks |
3-[(4-nitrobenzoyl)amino]propanoic acid (CAS 59642-21-6) is a chemical compound with the molecular formula C10H10N2O5 and a molecular weight of 238.20 g/mol. IUPAC name: 3-[(4-nitrobenzoyl)amino]propanoic acid. InChIKey: PDTLZWITKYGYDN-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O5 |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | 3-[(4-nitrobenzoyl)amino]propanoic acid |
| InChIKey | PDTLZWITKYGYDN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NCCC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)