CAS 298186-73-9 appears in our catalog under these names: [(4-Methyl-3-nitrobenzoyl)amino]acetic acid, 95%, 2-((4-Methyl-3-nitrophenyl)formamido)acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[(4-methyl-3-nitrobenzoyl)amino]acetic acid (CAS 298186-73-9) is a chemical compound with the molecular formula C10H10N2O5 and a molecular weight of 238.20 g/mol. IUPAC name: 2-[(4-methyl-3-nitrobenzoyl)amino]acetic acid. InChIKey: FBJVVYJQHFWBDF-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O5 |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | 2-[(4-methyl-3-nitrobenzoyl)amino]acetic acid |
| InChIKey | FBJVVYJQHFWBDF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)NCC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)