Products 5416-11-5

CAS 5416-11-5 is the registry number for Ethyl (4-nitrophenylamino) oxoacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(4-nitroanilino)-2-oxoacetate (CAS 5416-11-5) is a chemical compound with the molecular formula C10H10N2O5 and a molecular weight of 238.20 g/mol. IUPAC name: ethyl 2-(4-nitroanilino)-2-oxoacetate. InChIKey: LZAMLGBMDVNTOX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10N2O5
Molecular weight238.20 g/mol
IUPAC nameethyl 2-(4-nitroanilino)-2-oxoacetate
InChIKeyLZAMLGBMDVNTOX-UHFFFAOYSA-N
SMILESCCOC(=O)C(=O)NC1=CC=C(C=C1)[N+](=O)[O-]

Computed by PubChem (NCBI)