CAS 5416-11-5 is the registry number for Ethyl (4-nitrophenylamino) oxoacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Ethyl 2-(4-nitroanilino)-2-oxoacetate (CAS 5416-11-5) is a chemical compound with the molecular formula C10H10N2O5 and a molecular weight of 238.20 g/mol. IUPAC name: ethyl 2-(4-nitroanilino)-2-oxoacetate. InChIKey: LZAMLGBMDVNTOX-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O5 |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | ethyl 2-(4-nitroanilino)-2-oxoacetate |
| InChIKey | LZAMLGBMDVNTOX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)NC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)