Products 7356-52-7
CAS 7356-52-7 appears in our catalog under these names: 3-Acetamido-4-methyl-2-nitrobenzoic acid, 96%, 2–Nitro–3–Acetylamino–4–Methylbenzoic Acid, 3-Acetamido-4-methyl-2-nitrobenzoic acid 97%, 3-Acetamido-4-methyl-2-nitrobenzoic acid, 97%, 97%, 3-Acetamido-4-methyl-2-nitrobenzoic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 100g.
3-acetamido-4-methyl-2-nitrobenzoic acid (CAS 7356-52-7) is a chemical compound with the molecular formula C10H10N2O5 and a molecular weight of 238.20 g/mol. IUPAC name: 3-acetamido-4-methyl-2-nitrobenzoic acid. InChIKey: TXVWKWQKCFPEDJ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O5 |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | 3-acetamido-4-methyl-2-nitrobenzoic acid |
| InChIKey | TXVWKWQKCFPEDJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)O)[N+](=O)[O-])NC(=O)C |
Computed by PubChem (NCBI)